C22H32N4O11 — CID 86651439
4-nitrooxybutyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(4-nitrophenoxy)carbonylamino]hexanoate (PubChem CID 86651439) has the molecular formula C22H32N4O11 and a molecular weight of 528.52 g/mol. Its IUPAC name is 4-nitrooxybutyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(4-nitrophenoxy)carbonylamino]hexanoate.
| Compound Name | 4-nitrooxybutyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(4-nitrophenoxy)carbonylamino]hexanoate |
|---|---|
| PubChem CID | 86651439 |
| Molecular Formula | C22H32N4O11 |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 4-nitrooxybutyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(4-nitrophenoxy)carbonylamino]hexanoate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)Oc1ccc([N+](=O)[O-])cc1)C(=O)OCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C22H32N4O11/c1-22(2,3)37-20(28)23-13-5-4-8-18(19(27)34-14-6-7-15-35-26(32)33)24-21(29)36-17-11-9-16(10-12-17)25(30)31/h9-12,18H,4-8,13-15H2,1-3H3,(H,23,28)(H,24,29)/t18-/m0/s1 |
| InChIKey | NHQIGXBMUCFMPC-SFHVURJKSA-N |
| XLogP | 3.28 |
| TPSA | 198.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|