C22H32N4O11 — CID 87522548
butyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitrooxy-2-[(4-nitrophenoxy)carbonylamino]hexanoate (PubChem CID 87522548) has the molecular formula C22H32N4O11 and a molecular weight of 528.52 g/mol. Its IUPAC name is butyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitrooxy-2-[(4-nitrophenoxy)carbonylamino]hexanoate.
| Compound Name | butyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitrooxy-2-[(4-nitrophenoxy)carbonylamino]hexanoate |
|---|---|
| PubChem CID | 87522548 |
| Molecular Formula | C22H32N4O11 |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | butyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitrooxy-2-[(4-nitrophenoxy)carbonylamino]hexanoate |
| SMILES | CCCCOC(=O)C(CC(CCNC(=O)OC(C)(C)C)O[N+](=O)[O-])NC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H32N4O11/c1-5-6-13-34-19(27)18(24-21(29)35-16-9-7-15(8-10-16)25(30)31)14-17(37-26(32)33)11-12-23-20(28)36-22(2,3)4/h7-10,17-18H,5-6,11-14H2,1-4H3,(H,23,28)(H,24,29) |
| InChIKey | XUZQTCOSNBDSBQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 198.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|