C14H19N3O5 — CID 58165148
(4-nitrophenyl) N-(6-amino-5-methyl-6-oxohexyl)carbamate (PubChem CID 58165148) has the molecular formula C14H19N3O5 and a molecular weight of 309.32 g/mol. Its IUPAC name is (4-nitrophenyl) N-(6-amino-5-methyl-6-oxohexyl)carbamate.
| Compound Name | (4-nitrophenyl) N-(6-amino-5-methyl-6-oxohexyl)carbamate |
|---|---|
| PubChem CID | 58165148 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (4-nitrophenyl) N-(6-amino-5-methyl-6-oxohexyl)carbamate |
| SMILES | CC(CCCCNC(=O)Oc1ccc([N+](=O)[O-])cc1)C(N)=O |
| InChI | InChI=1S/C14H19N3O5/c1-10(13(15)18)4-2-3-9-16-14(19)22-12-7-5-11(6-8-12)17(20)21/h5-8,10H,2-4,9H2,1H3,(H2,15,18)(H,16,19) |
| InChIKey | DLWUJVVJOAKYMB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|