C22H18N4O8 — CID 57126958
(4-nitrophenyl) N-[[4-[[(4-nitrophenoxy)carbonylamino]methyl]phenyl]methyl]carbamate (PubChem CID 57126958) has the molecular formula C22H18N4O8 and a molecular weight of 466.41 g/mol. Its IUPAC name is (4-nitrophenyl) N-[[4-[[(4-nitrophenoxy)carbonylamino]methyl]phenyl]methyl]carbamate.
| Compound Name | (4-nitrophenyl) N-[[4-[[(4-nitrophenoxy)carbonylamino]methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 57126958 |
| Molecular Formula | C22H18N4O8 |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | (4-nitrophenyl) N-[[4-[[(4-nitrophenoxy)carbonylamino]methyl]phenyl]methyl]carbamate |
| SMILES | O=C(NCc1ccc(CNC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H18N4O8/c27-21(33-19-9-5-17(6-10-19)25(29)30)23-13-15-1-2-16(4-3-15)14-24-22(28)34-20-11-7-18(8-12-20)26(31)32/h1-12H,13-14H2,(H,23,27)(H,24,28) |
| InChIKey | IPHLBEPHUOLBDH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|