C15H13N3O6 — CID 174223547
[4-[(4-nitrophenoxy)carbonylamino]phenyl]methylcarbamic acid (PubChem CID 174223547) has the molecular formula C15H13N3O6 and a molecular weight of 331.28 g/mol. Its IUPAC name is [4-[(4-nitrophenoxy)carbonylamino]phenyl]methylcarbamic acid.
| Compound Name | [4-[(4-nitrophenoxy)carbonylamino]phenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 174223547 |
| Molecular Formula | C15H13N3O6 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | [4-[(4-nitrophenoxy)carbonylamino]phenyl]methylcarbamic acid |
| SMILES | O=C(O)NCc1ccc(NC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C15H13N3O6/c19-14(20)16-9-10-1-3-11(4-2-10)17-15(21)24-13-7-5-12(6-8-13)18(22)23/h1-8,16H,9H2,(H,17,21)(H,19,20) |
| InChIKey | VWAZOMXPISSZDN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|