C44H48N2O4 — CID 11411276
(4-nitrophenyl) N-[4-[tris(4-tert-butylphenyl)methyl]phenyl]carbamate (PubChem CID 11411276) has the molecular formula C44H48N2O4 and a molecular weight of 668.88 g/mol. Its IUPAC name is (4-nitrophenyl) N-[4-[tris(4-tert-butylphenyl)methyl]phenyl]carbamate.
| Compound Name | (4-nitrophenyl) N-[4-[tris(4-tert-butylphenyl)methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 11411276 |
| Molecular Formula | C44H48N2O4 |
| Molecular Weight | 668.88 g/mol |
| Exact Mass | 668.36 |
| IUPAC Name | (4-nitrophenyl) N-[4-[tris(4-tert-butylphenyl)methyl]phenyl]carbamate |
| SMILES | CC(C)(C)c1ccc(C(c2ccc(NC(=O)Oc3ccc([N+](=O)[O-])cc3)cc2)(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C44H48N2O4/c1-41(2,3)30-10-16-33(17-11-30)44(34-18-12-31(13-19-34)42(4,5)6,35-20-14-32(15-21-35)43(7,8)9)36-22-24-37(25-23-36)45-40(47)50-39-28-26-38(27-29-39)46(48)49/h10-29H,1-9H3,(H,45,47) |
| InChIKey | JHEBKENVFFZYDR-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.88 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|