C18H20N2O4 — CID 87699269
(4-tert-butylphenyl) N-[4-(hydroxycarbamoyl)phenyl]carbamate (PubChem CID 87699269) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is (4-tert-butylphenyl) N-[4-(hydroxycarbamoyl)phenyl]carbamate.
| Compound Name | (4-tert-butylphenyl) N-[4-(hydroxycarbamoyl)phenyl]carbamate |
|---|---|
| PubChem CID | 87699269 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (4-tert-butylphenyl) N-[4-(hydroxycarbamoyl)phenyl]carbamate |
| SMILES | CC(C)(C)c1ccc(OC(=O)Nc2ccc(C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C18H20N2O4/c1-18(2,3)13-6-10-15(11-7-13)24-17(22)19-14-8-4-12(5-9-14)16(21)20-23/h4-11,23H,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | FDWFPUPENKKDQM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|