C30H32N2O8 — CID 168866198
bis[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] benzene-1,4-dicarboxylate (PubChem CID 168866198) has the molecular formula C30H32N2O8 and a molecular weight of 548.59 g/mol. Its IUPAC name is bis[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 168866198 |
| Molecular Formula | C30H32N2O8 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | bis[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] benzene-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(OC(=O)c2ccc(C(=O)Oc3ccc(NC(=O)OC(C)(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H32N2O8/c1-29(2,3)39-27(35)31-21-11-15-23(16-12-21)37-25(33)19-7-9-20(10-8-19)26(34)38-24-17-13-22(14-18-24)32-28(36)40-30(4,5)6/h7-18H,1-6H3,(H,31,35)(H,32,36) |
| InChIKey | MRHFLOFEYATKLG-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|