C13H16ClNO3 — CID 74788467
tert-butyl N-[4-(2-chloroacetyl)phenyl]carbamate (PubChem CID 74788467) has the molecular formula C13H16ClNO3 and a molecular weight of 269.73 g/mol. Its IUPAC name is tert-butyl N-[4-(2-chloroacetyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-chloroacetyl)phenyl]carbamate |
|---|---|
| PubChem CID | 74788467 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | tert-butyl N-[4-(2-chloroacetyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(=O)CCl)cc1 |
| InChI | InChI=1S/C13H16ClNO3/c1-13(2,3)18-12(17)15-10-6-4-9(5-7-10)11(16)8-14/h4-7H,8H2,1-3H3,(H,15,17) |
| InChIKey | XKUGFBYCRGFMND-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|