C21H25N3O5 — CID 55736690
tert-butyl N-[4-[2-[(4-hydroxybenzoyl)amino]ethylcarbamoyl]phenyl]carbamate (PubChem CID 55736690) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[(4-hydroxybenzoyl)amino]ethylcarbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[(4-hydroxybenzoyl)amino]ethylcarbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 55736690 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | tert-butyl N-[4-[2-[(4-hydroxybenzoyl)amino]ethylcarbamoyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(=O)NCCNC(=O)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C21H25N3O5/c1-21(2,3)29-20(28)24-16-8-4-14(5-9-16)18(26)22-12-13-23-19(27)15-6-10-17(25)11-7-15/h4-11,25H,12-13H2,1-3H3,(H,22,26)(H,23,27)(H,24,28) |
| InChIKey | BVEIRRRVWNGLHL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|