C19H28N2O5 — CID 31840944
methyl 6-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoyl]amino]hexanoate (PubChem CID 31840944) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is methyl 6-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoyl]amino]hexanoate.
| Compound Name | methyl 6-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoyl]amino]hexanoate |
|---|---|
| PubChem CID | 31840944 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | methyl 6-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)c1ccc(NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H28N2O5/c1-19(2,3)26-18(24)21-15-11-9-14(10-12-15)17(23)20-13-7-5-6-8-16(22)25-4/h9-12H,5-8,13H2,1-4H3,(H,20,23)(H,21,24) |
| InChIKey | ORNANSFNBDKLEF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|