C21H35NO4S — CID 144961973
ethane;methyl 7-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]sulfanylheptanoate (PubChem CID 144961973) has the molecular formula C21H35NO4S and a molecular weight of 397.58 g/mol. Its IUPAC name is ethane;methyl 7-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]sulfanylheptanoate.
| Compound Name | ethane;methyl 7-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]sulfanylheptanoate |
|---|---|
| PubChem CID | 144961973 |
| Molecular Formula | C21H35NO4S |
| Molecular Weight | 397.58 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | ethane;methyl 7-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]sulfanylheptanoate |
| SMILES | CC.COC(=O)CCCCCCSc1ccc(NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H29NO4S.C2H6/c1-19(2,3)24-18(22)20-15-10-12-16(13-11-15)25-14-8-6-5-7-9-17(21)23-4;1-2/h10-13H,5-9,14H2,1-4H3,(H,20,22);1-2H3 |
| InChIKey | RVVNCUBXYAEJBS-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.58 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|