C28H44N2O6 — CID 3310554
methyl 10-[4-[(10-methoxy-10-oxodecanoyl)amino]anilino]-10-oxodecanoate (PubChem CID 3310554) has the molecular formula C28H44N2O6 and a molecular weight of 504.67 g/mol. Its IUPAC name is methyl 10-[4-[(10-methoxy-10-oxodecanoyl)amino]anilino]-10-oxodecanoate.
| Compound Name | methyl 10-[4-[(10-methoxy-10-oxodecanoyl)amino]anilino]-10-oxodecanoate |
|---|---|
| PubChem CID | 3310554 |
| Molecular Formula | C28H44N2O6 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | methyl 10-[4-[(10-methoxy-10-oxodecanoyl)amino]anilino]-10-oxodecanoate |
| SMILES | COC(=O)CCCCCCCCC(=O)Nc1ccc(NC(=O)CCCCCCCCC(=O)OC)cc1 |
| InChI | InChI=1S/C28H44N2O6/c1-35-27(33)17-13-9-5-3-7-11-15-25(31)29-23-19-21-24(22-20-23)30-26(32)16-12-8-4-6-10-14-18-28(34)36-2/h19-22H,3-18H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | DGLXJWUTVCTYDO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|