C21H32N2O5 — CID 166583715
methyl 8-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]anilino]-8-oxooctanoate (PubChem CID 166583715) has the molecular formula C21H32N2O5 and a molecular weight of 392.50 g/mol. Its IUPAC name is methyl 8-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]anilino]-8-oxooctanoate.
| Compound Name | methyl 8-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]anilino]-8-oxooctanoate |
|---|---|
| PubChem CID | 166583715 |
| Molecular Formula | C21H32N2O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | methyl 8-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]anilino]-8-oxooctanoate |
| SMILES | COC(=O)CCCCCCC(=O)Nc1ccc(N(C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H32N2O5/c1-21(2,3)28-20(26)23(4)17-14-12-16(13-15-17)22-18(24)10-8-6-7-9-11-19(25)27-5/h12-15H,6-11H2,1-5H3,(H,22,24) |
| InChIKey | QWGCNOUCMUYTRB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|