C22H36N2O4 — CID 58024758
tert-butyl 4-[8-[2-hydroxyethyl(methyl)amino]octanoylamino]benzoate (PubChem CID 58024758) has the molecular formula C22H36N2O4 and a molecular weight of 392.54 g/mol. Its IUPAC name is tert-butyl 4-[8-[2-hydroxyethyl(methyl)amino]octanoylamino]benzoate.
| Compound Name | tert-butyl 4-[8-[2-hydroxyethyl(methyl)amino]octanoylamino]benzoate |
|---|---|
| PubChem CID | 58024758 |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | tert-butyl 4-[8-[2-hydroxyethyl(methyl)amino]octanoylamino]benzoate |
| SMILES | CN(CCO)CCCCCCCC(=O)Nc1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H36N2O4/c1-22(2,3)28-21(27)18-11-13-19(14-12-18)23-20(26)10-8-6-5-7-9-15-24(4)16-17-25/h11-14,25H,5-10,15-17H2,1-4H3,(H,23,26) |
| InChIKey | PMUIDDQAQZRVBX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|