C23H28N2O5 — CID 25179118
tert-butyl 4-[[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]carbamoylamino]benzoate (PubChem CID 25179118) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is tert-butyl 4-[[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]carbamoylamino]benzoate.
| Compound Name | tert-butyl 4-[[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 25179118 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | tert-butyl 4-[[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]carbamoylamino]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(NC(=O)Nc2ccc(C(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H28N2O5/c1-22(2,3)29-19(26)15-7-11-17(12-8-15)24-21(28)25-18-13-9-16(10-14-18)20(27)30-23(4,5)6/h7-14H,1-6H3,(H2,24,25,28) |
| InChIKey | ASQCZWWTQPITLT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |