C16H26N2O4 — CID 70440346
ditert-butyl benzene-1,4-dicarboxylate;hydrazine (PubChem CID 70440346) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is ditert-butyl benzene-1,4-dicarboxylate;hydrazine.
| Compound Name | ditert-butyl benzene-1,4-dicarboxylate;hydrazine |
|---|---|
| PubChem CID | 70440346 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | ditert-butyl benzene-1,4-dicarboxylate;hydrazine |
| SMILES | CC(C)(C)OC(=O)c1ccc(C(=O)OC(C)(C)C)cc1.NN |
| InChI | InChI=1S/C16H22O4.H4N2/c1-15(2,3)19-13(17)11-7-9-12(10-8-11)14(18)20-16(4,5)6;1-2/h7-10H,1-6H3;1-2H2 |
| InChIKey | JRZRUXJAILDLON-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|