About tert-butyl 4-isocyanobenzoate
tert-butyl 4-isocyanobenzoate (PubChem CID 91619162) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is tert-butyl 4-isocyanobenzoate.
Molecular Properties
| Compound Name | tert-butyl 4-isocyanobenzoate |
| PubChem CID | 91619162 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | tert-butyl 4-isocyanobenzoate |
| SMILES | [C-]#[N+]c1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C12H13NO2/c1-12(2,3)15-11(14)9-5-7-10(13-4)8-6-9/h5-8H,1-3H3 |
| InChIKey | RGQKDBWDGMIOCX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-isocyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-isocyanobenzoate?
The IUPAC name of tert-butyl 4-isocyanobenzoate (CID 91619162) is tert-butyl 4-isocyanobenzoate.
What is the SMILES notation for tert-butyl 4-isocyanobenzoate?
The canonical SMILES for tert-butyl 4-isocyanobenzoate is [C-]#[N+]c1ccc(C(=O)OC(C)(C)C)cc1.
What is the InChIKey of tert-butyl 4-isocyanobenzoate?
The InChIKey is RGQKDBWDGMIOCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c1-12(2,3)15-11(14)9-5-7-10(13-4)8-6-9/h5-8H,1-3H3.
What are the key properties of tert-butyl 4-isocyanobenzoate?
tert-butyl 4-isocyanobenzoate has a molecular weight of 203.24 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-isocyanobenzoate is sourced from PubChem (CID 91619162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).