C16H21N3O3 — CID 140808849
tert-butyl N-[3-[(4-isocyanobenzoyl)amino]propyl]carbamate (PubChem CID 140808849) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is tert-butyl N-[3-[(4-isocyanobenzoyl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(4-isocyanobenzoyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 140808849 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | tert-butyl N-[3-[(4-isocyanobenzoyl)amino]propyl]carbamate |
| SMILES | [C-]#[N+]c1ccc(C(=O)NCCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H21N3O3/c1-16(2,3)22-15(21)19-11-5-10-18-14(20)12-6-8-13(17-4)9-7-12/h6-9H,5,10-11H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | DCVQMVVUKRXKOT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|