C20H32N4O6 — CID 87361941
tert-butyl N-[3-[[4-[[(2S,3R)-3-hydroxy-1-(hydroxyamino)butan-2-yl]carbamoyl]benzoyl]amino]propyl]carbamate (PubChem CID 87361941) has the molecular formula C20H32N4O6 and a molecular weight of 424.50 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-[[(2S,3R)-3-hydroxy-1-(hydroxyamino)butan-2-yl]carbamoyl]benzoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-[[(2S,3R)-3-hydroxy-1-(hydroxyamino)butan-2-yl]carbamoyl]benzoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 87361941 |
| Molecular Formula | C20H32N4O6 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | tert-butyl N-[3-[[4-[[(2S,3R)-3-hydroxy-1-(hydroxyamino)butan-2-yl]carbamoyl]benzoyl]amino]propyl]carbamate |
| SMILES | C[C@@H](O)[C@H](CNO)NC(=O)c1ccc(C(=O)NCCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H32N4O6/c1-13(25)16(12-23-29)24-18(27)15-8-6-14(7-9-15)17(26)21-10-5-11-22-19(28)30-20(2,3)4/h6-9,13,16,23,25,29H,5,10-12H2,1-4H3,(H,21,26)(H,22,28)(H,24,27)/t13-,16+/m1/s1 |
| InChIKey | NMUDPASBVQZXKJ-CJNGLKHVSA-N |
| XLogP | 0.79 |
| TPSA | 149.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|