C20H30F3N5O3 — CID 111886993
tert-butyl N-[3-[[N'-methyl-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]carbamimidoyl]amino]propyl]carbamate (PubChem CID 111886993) has the molecular formula C20H30F3N5O3 and a molecular weight of 445.49 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-methyl-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]carbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N'-methyl-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]carbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111886993 |
| Molecular Formula | C20H30F3N5O3 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | tert-butyl N-[3-[[N'-methyl-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]carbamimidoyl]amino]propyl]carbamate |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCCNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H30F3N5O3/c1-19(2,3)31-18(30)28-11-5-10-26-17(24-4)27-13-12-25-16(29)14-6-8-15(9-7-14)20(21,22)23/h6-9H,5,10-13H2,1-4H3,(H,25,29)(H,28,30)(H2,24,26,27) |
| InChIKey | LFVKWLVNFFEEQP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|