C22H37N5O3 — CID 111887005
tert-butyl N-[3-[[N-[[4-(butylcarbamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate (PubChem CID 111887005) has the molecular formula C22H37N5O3 and a molecular weight of 419.57 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-[[4-(butylcarbamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N-[[4-(butylcarbamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111887005 |
| Molecular Formula | C22H37N5O3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | tert-butyl N-[3-[[N-[[4-(butylcarbamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate |
| SMILES | CCCCNC(=O)c1ccc(CN/C(=N/C)NCCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H37N5O3/c1-6-7-13-24-19(28)18-11-9-17(10-12-18)16-27-20(23-5)25-14-8-15-26-21(29)30-22(2,3)4/h9-12H,6-8,13-16H2,1-5H3,(H,24,28)(H,26,29)(H2,23,25,27) |
| InChIKey | FGTRFQAAQPWCQH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|