C23H39N5O3 — CID 111886903
tert-butyl N-[3-[[N'-[[4-(butylcarbamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate (PubChem CID 111886903) has the molecular formula C23H39N5O3 and a molecular weight of 433.60 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-[[4-(butylcarbamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N'-[[4-(butylcarbamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111886903 |
| Molecular Formula | C23H39N5O3 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | tert-butyl N-[3-[[N'-[[4-(butylcarbamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate |
| SMILES | CCCCNC(=O)c1ccc(C/N=C(\NCC)NCCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H39N5O3/c1-6-8-14-25-20(29)19-12-10-18(11-13-19)17-28-21(24-7-2)26-15-9-16-27-22(30)31-23(3,4)5/h10-13H,6-9,14-17H2,1-5H3,(H,25,29)(H,27,30)(H2,24,26,28) |
| InChIKey | ZGEFDUAAXZFSDE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|