C24H39N5O3 — CID 111886241
tert-butyl N-[3-[[N-ethyl-N'-[[4-(piperidine-1-carbonyl)phenyl]methyl]carbamimidoyl]amino]propyl]carbamate (PubChem CID 111886241) has the molecular formula C24H39N5O3 and a molecular weight of 445.61 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-ethyl-N'-[[4-(piperidine-1-carbonyl)phenyl]methyl]carbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N-ethyl-N'-[[4-(piperidine-1-carbonyl)phenyl]methyl]carbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111886241 |
| Molecular Formula | C24H39N5O3 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.31 |
| IUPAC Name | tert-butyl N-[3-[[N-ethyl-N'-[[4-(piperidine-1-carbonyl)phenyl]methyl]carbamimidoyl]amino]propyl]carbamate |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N2CCCCC2)cc1)NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H39N5O3/c1-5-25-22(26-14-9-15-27-23(31)32-24(2,3)4)28-18-19-10-12-20(13-11-19)21(30)29-16-7-6-8-17-29/h10-13H,5-9,14-18H2,1-4H3,(H,27,31)(H2,25,26,28) |
| InChIKey | NTEYPJCNYNYDCG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|