C16H18F6N2O3 — CID 52778261
tert-butyl N-[2-[[3,5-bis(trifluoromethyl)benzoyl]amino]ethyl]carbamate (PubChem CID 52778261) has the molecular formula C16H18F6N2O3 and a molecular weight of 400.32 g/mol. Its IUPAC name is tert-butyl N-[2-[[3,5-bis(trifluoromethyl)benzoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3,5-bis(trifluoromethyl)benzoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 52778261 |
| Molecular Formula | C16H18F6N2O3 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | tert-butyl N-[2-[[3,5-bis(trifluoromethyl)benzoyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H18F6N2O3/c1-14(2,3)27-13(26)24-5-4-23-12(25)9-6-10(15(17,18)19)8-11(7-9)16(20,21)22/h6-8H,4-5H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | UUVKWZQYEZINFR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|