C12H10BrF6NO — CID 132941155
N-(3-bromopropyl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 132941155) has the molecular formula C12H10BrF6NO and a molecular weight of 378.11 g/mol. Its IUPAC name is N-(3-bromopropyl)-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(3-bromopropyl)-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 132941155 |
| Molecular Formula | C12H10BrF6NO |
| Molecular Weight | 378.11 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | N-(3-bromopropyl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(NCCCBr)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10BrF6NO/c13-2-1-3-20-10(21)7-4-8(11(14,15)16)6-9(5-7)12(17,18)19/h4-6H,1-3H2,(H,20,21) |
| InChIKey | ANSTXCWVEVLPHS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.11 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|