C19H15ClF6N2O2 — CID 46225306
N-[4-(4-chloroanilino)-4-oxobutyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 46225306) has the molecular formula C19H15ClF6N2O2 and a molecular weight of 452.78 g/mol. Its IUPAC name is N-[4-(4-chloroanilino)-4-oxobutyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[4-(4-chloroanilino)-4-oxobutyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 46225306 |
| Molecular Formula | C19H15ClF6N2O2 |
| Molecular Weight | 452.78 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | N-[4-(4-chloroanilino)-4-oxobutyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(CCCNC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15ClF6N2O2/c20-14-3-5-15(6-4-14)28-16(29)2-1-7-27-17(30)11-8-12(18(21,22)23)10-13(9-11)19(24,25)26/h3-6,8-10H,1-2,7H2,(H,27,30)(H,28,29) |
| InChIKey | OCRRQEKHNZAYPW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.78 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|