C17H15ClFIN2O2 — CID 55861961
N-[4-(4-chloroanilino)-4-oxobutyl]-4-fluoro-2-iodobenzamide (PubChem CID 55861961) has the molecular formula C17H15ClFIN2O2 and a molecular weight of 460.67 g/mol. Its IUPAC name is N-[4-(4-chloroanilino)-4-oxobutyl]-4-fluoro-2-iodobenzamide.
| Compound Name | N-[4-(4-chloroanilino)-4-oxobutyl]-4-fluoro-2-iodobenzamide |
|---|---|
| PubChem CID | 55861961 |
| Molecular Formula | C17H15ClFIN2O2 |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 459.99 |
| IUPAC Name | N-[4-(4-chloroanilino)-4-oxobutyl]-4-fluoro-2-iodobenzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1I)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClFIN2O2/c18-11-3-6-13(7-4-11)22-16(23)2-1-9-21-17(24)14-8-5-12(19)10-15(14)20/h3-8,10H,1-2,9H2,(H,21,24)(H,22,23) |
| InChIKey | GOUIEIZKGOZKAS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|