C20H17F2N3O2S — CID 24648849
2,4-difluoro-N-[4-oxo-4-[4-(1,3-thiazol-2-yl)anilino]butyl]benzamide (PubChem CID 24648849) has the molecular formula C20H17F2N3O2S and a molecular weight of 401.44 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-oxo-4-[4-(1,3-thiazol-2-yl)anilino]butyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-oxo-4-[4-(1,3-thiazol-2-yl)anilino]butyl]benzamide |
|---|---|
| PubChem CID | 24648849 |
| Molecular Formula | C20H17F2N3O2S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 2,4-difluoro-N-[4-oxo-4-[4-(1,3-thiazol-2-yl)anilino]butyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1F)Nc1ccc(-c2nccs2)cc1 |
| InChI | InChI=1S/C20H17F2N3O2S/c21-14-5-8-16(17(22)12-14)19(27)23-9-1-2-18(26)25-15-6-3-13(4-7-15)20-24-10-11-28-20/h3-8,10-12H,1-2,9H2,(H,23,27)(H,25,26) |
| InChIKey | QMQPUOWZTWCREV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|