C16H10F2N2OS — CID 17487764
2,5-difluoro-N-[4-(1,3-thiazol-2-yl)phenyl]benzamide (PubChem CID 17487764) has the molecular formula C16H10F2N2OS and a molecular weight of 316.33 g/mol. Its IUPAC name is 2,5-difluoro-N-[4-(1,3-thiazol-2-yl)phenyl]benzamide.
| Compound Name | 2,5-difluoro-N-[4-(1,3-thiazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 17487764 |
| Molecular Formula | C16H10F2N2OS |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2,5-difluoro-N-[4-(1,3-thiazol-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2nccs2)cc1)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H10F2N2OS/c17-11-3-6-14(18)13(9-11)15(21)20-12-4-1-10(2-5-12)16-19-7-8-22-16/h1-9H,(H,20,21) |
| InChIKey | IHYSKOKHYNQPHQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |