C16H14N2O2S — CID 27702222
2,5-dimethyl-N-[4-(1,3-thiazol-2-yl)phenyl]furan-3-carboxamide (PubChem CID 27702222) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 2,5-dimethyl-N-[4-(1,3-thiazol-2-yl)phenyl]furan-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[4-(1,3-thiazol-2-yl)phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 27702222 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2,5-dimethyl-N-[4-(1,3-thiazol-2-yl)phenyl]furan-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(-c3nccs3)cc2)c(C)o1 |
| InChI | InChI=1S/C16H14N2O2S/c1-10-9-14(11(2)20-10)15(19)18-13-5-3-12(4-6-13)16-17-7-8-21-16/h3-9H,1-2H3,(H,18,19) |
| InChIKey | YAXRAHXSDCNKCG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |