C16H11FN2OS — CID 8795595
3-fluoro-N-[4-(1,3-thiazol-2-yl)phenyl]benzamide (PubChem CID 8795595) has the molecular formula C16H11FN2OS and a molecular weight of 298.34 g/mol. Its IUPAC name is 3-fluoro-N-[4-(1,3-thiazol-2-yl)phenyl]benzamide.
| Compound Name | 3-fluoro-N-[4-(1,3-thiazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 8795595 |
| Molecular Formula | C16H11FN2OS |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 3-fluoro-N-[4-(1,3-thiazol-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2nccs2)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C16H11FN2OS/c17-13-3-1-2-12(10-13)15(20)19-14-6-4-11(5-7-14)16-18-8-9-21-16/h1-10H,(H,19,20) |
| InChIKey | ZCWMZVHNMJJUHL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |