C19H16N2O4S — CID 55875358
methyl 2-[3-[[4-(1,3-thiazol-2-yl)phenyl]carbamoyl]phenoxy]acetate (PubChem CID 55875358) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is methyl 2-[3-[[4-(1,3-thiazol-2-yl)phenyl]carbamoyl]phenoxy]acetate.
| Compound Name | methyl 2-[3-[[4-(1,3-thiazol-2-yl)phenyl]carbamoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 55875358 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | methyl 2-[3-[[4-(1,3-thiazol-2-yl)phenyl]carbamoyl]phenoxy]acetate |
| SMILES | COC(=O)COc1cccc(C(=O)Nc2ccc(-c3nccs3)cc2)c1 |
| InChI | InChI=1S/C19H16N2O4S/c1-24-17(22)12-25-16-4-2-3-14(11-16)18(23)21-15-7-5-13(6-8-15)19-20-9-10-26-19/h2-11H,12H2,1H3,(H,21,23) |
| InChIKey | NYULFWRGYFOMHR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |