C21H16N2O2S — CID 9114839
3-methoxy-N-[4-(1,3-thiazol-2-yl)phenyl]naphthalene-2-carboxamide (PubChem CID 9114839) has the molecular formula C21H16N2O2S and a molecular weight of 360.44 g/mol. Its IUPAC name is 3-methoxy-N-[4-(1,3-thiazol-2-yl)phenyl]naphthalene-2-carboxamide.
| Compound Name | 3-methoxy-N-[4-(1,3-thiazol-2-yl)phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 9114839 |
| Molecular Formula | C21H16N2O2S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 3-methoxy-N-[4-(1,3-thiazol-2-yl)phenyl]naphthalene-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)Nc1ccc(-c2nccs2)cc1 |
| InChI | InChI=1S/C21H16N2O2S/c1-25-19-13-16-5-3-2-4-15(16)12-18(19)20(24)23-17-8-6-14(7-9-17)21-22-10-11-26-21/h2-13H,1H3,(H,23,24) |
| InChIKey | NRRQCAQMANDJHM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |