C18H17N3O2S — CID 54773947
1-(4-methoxyphenyl)-3-[[4-(1,3-thiazol-2-yl)phenyl]methyl]urea (PubChem CID 54773947) has the molecular formula C18H17N3O2S and a molecular weight of 339.42 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[[4-(1,3-thiazol-2-yl)phenyl]methyl]urea.
| Compound Name | 1-(4-methoxyphenyl)-3-[[4-(1,3-thiazol-2-yl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 54773947 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[[4-(1,3-thiazol-2-yl)phenyl]methyl]urea |
| SMILES | COc1ccc(NC(=O)NCc2ccc(-c3nccs3)cc2)cc1 |
| InChI | InChI=1S/C18H17N3O2S/c1-23-16-8-6-15(7-9-16)21-18(22)20-12-13-2-4-14(5-3-13)17-19-10-11-24-17/h2-11H,12H2,1H3,(H2,20,21,22) |
| InChIKey | DTJGUVWZDKNYFG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |