C17H15N3OS — CID 60545932
1-benzyl-3-[3-(1,3-thiazol-2-yl)phenyl]urea (PubChem CID 60545932) has the molecular formula C17H15N3OS and a molecular weight of 309.39 g/mol. Its IUPAC name is 1-benzyl-3-[3-(1,3-thiazol-2-yl)phenyl]urea.
| Compound Name | 1-benzyl-3-[3-(1,3-thiazol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 60545932 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 1-benzyl-3-[3-(1,3-thiazol-2-yl)phenyl]urea |
| SMILES | O=C(NCc1ccccc1)Nc1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C17H15N3OS/c21-17(19-12-13-5-2-1-3-6-13)20-15-8-4-7-14(11-15)16-18-9-10-22-16/h1-11H,12H2,(H2,19,20,21) |
| InChIKey | PTEZZDKDISFGOG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |