C17H16N4OS — CID 56823567
1-[3-(4-methyl-1,3-thiazol-2-yl)phenyl]-3-(pyridin-4-ylmethyl)urea (PubChem CID 56823567) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-[3-(4-methyl-1,3-thiazol-2-yl)phenyl]-3-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-[3-(4-methyl-1,3-thiazol-2-yl)phenyl]-3-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 56823567 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 1-[3-(4-methyl-1,3-thiazol-2-yl)phenyl]-3-(pyridin-4-ylmethyl)urea |
| SMILES | Cc1csc(-c2cccc(NC(=O)NCc3ccncc3)c2)n1 |
| InChI | InChI=1S/C17H16N4OS/c1-12-11-23-16(20-12)14-3-2-4-15(9-14)21-17(22)19-10-13-5-7-18-8-6-13/h2-9,11H,10H2,1H3,(H2,19,21,22) |
| InChIKey | VATAACOVVUVVEV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |