C9H9ClN2S — CID 54605031
4-methyl-2-pyridin-4-yl-1,3-thiazole;hydrochloride (PubChem CID 54605031) has the molecular formula C9H9ClN2S and a molecular weight of 212.71 g/mol. Its IUPAC name is 4-methyl-2-pyridin-4-yl-1,3-thiazole;hydrochloride.
| Compound Name | 4-methyl-2-pyridin-4-yl-1,3-thiazole;hydrochloride |
|---|---|
| PubChem CID | 54605031 |
| Molecular Formula | C9H9ClN2S |
| Molecular Weight | 212.71 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 4-methyl-2-pyridin-4-yl-1,3-thiazole;hydrochloride |
| SMILES | Cc1csc(-c2ccncc2)n1.Cl |
| InChI | InChI=1S/C9H8N2S.ClH/c1-7-6-12-9(11-7)8-2-4-10-5-3-8;/h2-6H,1H3;1H |
| InChIKey | AUSNDQWKSYHTTN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.71 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |