C12H14BrNS — CID 145337663
2-(4-bromophenyl)-4-methyl-1,3-thiazole;ethane (PubChem CID 145337663) has the molecular formula C12H14BrNS and a molecular weight of 284.22 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-methyl-1,3-thiazole;ethane.
| Compound Name | 2-(4-bromophenyl)-4-methyl-1,3-thiazole;ethane |
|---|---|
| PubChem CID | 145337663 |
| Molecular Formula | C12H14BrNS |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 2-(4-bromophenyl)-4-methyl-1,3-thiazole;ethane |
| SMILES | CC.Cc1csc(-c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C10H8BrNS.C2H6/c1-7-6-13-10(12-7)8-2-4-9(11)5-3-8;1-2/h2-6H,1H3;1-2H3 |
| InChIKey | HHQTUOPYEDRAIT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |