C9H5BrNNaO2S2 — CID 165455171
sodium 2-(4-bromophenyl)-1,3-thiazole-4-sulfinate (PubChem CID 165455171) has the molecular formula C9H5BrNNaO2S2 and a molecular weight of 326.17 g/mol. Its IUPAC name is sodium 2-(4-bromophenyl)-1,3-thiazole-4-sulfinate.
| Compound Name | sodium 2-(4-bromophenyl)-1,3-thiazole-4-sulfinate |
|---|---|
| PubChem CID | 165455171 |
| Molecular Formula | C9H5BrNNaO2S2 |
| Molecular Weight | 326.17 g/mol |
| Exact Mass | 324.88 |
| IUPAC Name | sodium 2-(4-bromophenyl)-1,3-thiazole-4-sulfinate |
| SMILES | O=S([O-])c1csc(-c2ccc(Br)cc2)n1.[Na+] |
| InChI | InChI=1S/C9H6BrNO2S2.Na/c10-7-3-1-6(2-4-7)9-11-8(5-14-9)15(12)13;/h1-5H,(H,12,13);/q;+1/p-1 |
| InChIKey | KJKXZBXFONBYCI-UHFFFAOYSA-M |
| XLogP | -0.19 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.17 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|