C15H17BrN2S — CID 116888872
4-[2-(4-bromophenyl)-1,3-thiazol-4-yl]cyclohexan-1-amine (PubChem CID 116888872) has the molecular formula C15H17BrN2S and a molecular weight of 337.29 g/mol. Its IUPAC name is 4-[2-(4-bromophenyl)-1,3-thiazol-4-yl]cyclohexan-1-amine.
| Compound Name | 4-[2-(4-bromophenyl)-1,3-thiazol-4-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 116888872 |
| Molecular Formula | C15H17BrN2S |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 4-[2-(4-bromophenyl)-1,3-thiazol-4-yl]cyclohexan-1-amine |
| SMILES | NC1CCC(c2csc(-c3ccc(Br)cc3)n2)CC1 |
| InChI | InChI=1S/C15H17BrN2S/c16-12-5-1-11(2-6-12)15-18-14(9-19-15)10-3-7-13(17)8-4-10/h1-2,5-6,9-10,13H,3-4,7-8,17H2 |
| InChIKey | GELUJOMFJQPQRX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |