C10H7BrFNS — CID 82488398
2-(3-bromo-4-fluorophenyl)-4-methyl-1,3-thiazole (PubChem CID 82488398) has the molecular formula C10H7BrFNS and a molecular weight of 272.14 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-4-methyl-1,3-thiazole.
| Compound Name | 2-(3-bromo-4-fluorophenyl)-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 82488398 |
| Molecular Formula | C10H7BrFNS |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 270.95 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-4-methyl-1,3-thiazole |
| SMILES | Cc1csc(-c2ccc(F)c(Br)c2)n1 |
| InChI | InChI=1S/C10H7BrFNS/c1-6-5-14-10(13-6)7-2-3-9(12)8(11)4-7/h2-5H,1H3 |
| InChIKey | LNNHTNUOQHGWCD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |