C12H10FNO2S — CID 172532469
methyl 2-fluoro-4-(4-methyl-1,3-thiazol-2-yl)benzoate (PubChem CID 172532469) has the molecular formula C12H10FNO2S and a molecular weight of 251.28 g/mol. Its IUPAC name is methyl 2-fluoro-4-(4-methyl-1,3-thiazol-2-yl)benzoate.
| Compound Name | methyl 2-fluoro-4-(4-methyl-1,3-thiazol-2-yl)benzoate |
|---|---|
| PubChem CID | 172532469 |
| Molecular Formula | C12H10FNO2S |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | methyl 2-fluoro-4-(4-methyl-1,3-thiazol-2-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2nc(C)cs2)cc1F |
| InChI | InChI=1S/C12H10FNO2S/c1-7-6-17-11(14-7)8-3-4-9(10(13)5-8)12(15)16-2/h3-6H,1-2H3 |
| InChIKey | JLBXOZXOQNTKMD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |