About methyl 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate
methyl 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate (PubChem CID 172533149) has the molecular formula C11H9FN2O3
and a molecular weight of 236.20 g/mol. Its IUPAC name is methyl 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate.
Analyze methyl 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate?
The IUPAC name of methyl 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate (CID 172533149) is methyl 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate.
What is the SMILES notation for methyl 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate?
The canonical SMILES for methyl 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate is COC(=O)c1ccc(-c2nc(C)no2)cc1F.
What is the InChIKey of methyl 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate?
The InChIKey is WBWSGLGTQZKNII-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FN2O3/c1-6-13-10(17-14-6)7-3-4-8(9(12)5-7)11(15)16-2/h3-5H,1-2H3.
What are the key properties of methyl 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate?
methyl 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate has a molecular weight of 236.20 g/mol, XLogP of 1.97, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate is sourced from PubChem (CID 172533149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).