C18H15NO5S2 — CID 35395245
methyl 3-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]sulfonylbenzoate (PubChem CID 35395245) has the molecular formula C18H15NO5S2 and a molecular weight of 389.45 g/mol. Its IUPAC name is methyl 3-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]sulfonylbenzoate.
| Compound Name | methyl 3-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]sulfonylbenzoate |
|---|---|
| PubChem CID | 35395245 |
| Molecular Formula | C18H15NO5S2 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | methyl 3-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]sulfonylbenzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)Oc2ccc(-c3nc(C)cs3)cc2)c1 |
| InChI | InChI=1S/C18H15NO5S2/c1-12-11-25-17(19-12)13-6-8-15(9-7-13)24-26(21,22)16-5-3-4-14(10-16)18(20)23-2/h3-11H,1-2H3 |
| InChIKey | LSCMSEXRPDFDPD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|