C18H15NO3S — CID 18613878
methyl 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]benzoate (PubChem CID 18613878) has the molecular formula C18H15NO3S and a molecular weight of 325.39 g/mol. Its IUPAC name is methyl 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]benzoate.
| Compound Name | methyl 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]benzoate |
|---|---|
| PubChem CID | 18613878 |
| Molecular Formula | C18H15NO3S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | methyl 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2nc(-c3ccc(OC)cc3)cs2)c1 |
| InChI | InChI=1S/C18H15NO3S/c1-21-15-8-6-12(7-9-15)16-11-23-17(19-16)13-4-3-5-14(10-13)18(20)22-2/h3-11H,1-2H3 |
| InChIKey | SPYJBSBUTWVBQN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |