C31H24N2O2S — CID 108751458
(E)-3-(4-methoxyphenyl)-2-phenyl-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]prop-2-enamide (PubChem CID 108751458) has the molecular formula C31H24N2O2S and a molecular weight of 488.61 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-2-phenyl-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-methoxyphenyl)-2-phenyl-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108751458 |
| Molecular Formula | C31H24N2O2S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-2-phenyl-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C(/C(=O)Nc2ccc(-c3csc(-c4ccccc4)n3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H24N2O2S/c1-35-27-18-12-22(13-19-27)20-28(23-8-4-2-5-9-23)30(34)32-26-16-14-24(15-17-26)29-21-36-31(33-29)25-10-6-3-7-11-25/h2-21H,1H3,(H,32,34)/b28-20+ |
| InChIKey | GXVYRMQWUFGUOR-VFCFBJKWSA-N |
| XLogP | 7.66 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|