C30H21ClN2OS — CID 108770304
(Z)-N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-2,3-diphenylprop-2-enamide (PubChem CID 108770304) has the molecular formula C30H21ClN2OS and a molecular weight of 493.03 g/mol. Its IUPAC name is (Z)-N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-2,3-diphenylprop-2-enamide.
| Compound Name | (Z)-N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 108770304 |
| Molecular Formula | C30H21ClN2OS |
| Molecular Weight | 493.03 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | (Z)-N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-2,3-diphenylprop-2-enamide |
| SMILES | O=C(Nc1cccc(-c2csc(-c3ccccc3Cl)n2)c1)/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H21ClN2OS/c31-27-17-8-7-16-25(27)30-33-28(20-35-30)23-14-9-15-24(19-23)32-29(34)26(22-12-5-2-6-13-22)18-21-10-3-1-4-11-21/h1-20H,(H,32,34)/b26-18- |
| InChIKey | NMRKOLFDBIVZBO-ITYLOYPMSA-N |
| XLogP | 8.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.03 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|