C19H16BrClN2OS — CID 108748311
2-bromo-N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]butanamide (PubChem CID 108748311) has the molecular formula C19H16BrClN2OS and a molecular weight of 435.77 g/mol. Its IUPAC name is 2-bromo-N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]butanamide.
| Compound Name | 2-bromo-N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]butanamide |
|---|---|
| PubChem CID | 108748311 |
| Molecular Formula | C19H16BrClN2OS |
| Molecular Weight | 435.77 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | 2-bromo-N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]butanamide |
| SMILES | CCC(Br)C(=O)Nc1cccc(-c2csc(-c3ccccc3Cl)n2)c1 |
| InChI | InChI=1S/C19H16BrClN2OS/c1-2-15(20)18(24)22-13-7-5-6-12(10-13)17-11-25-19(23-17)14-8-3-4-9-16(14)21/h3-11,15H,2H2,1H3,(H,22,24) |
| InChIKey | AXJIBLDDIICDCG-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.77 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|