C24H27ClN2O2S — CID 108748322
2-ethylhexyl N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]carbamate (PubChem CID 108748322) has the molecular formula C24H27ClN2O2S and a molecular weight of 443.01 g/mol. Its IUPAC name is 2-ethylhexyl N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]carbamate.
| Compound Name | 2-ethylhexyl N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 108748322 |
| Molecular Formula | C24H27ClN2O2S |
| Molecular Weight | 443.01 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 2-ethylhexyl N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]carbamate |
| SMILES | CCCCC(CC)COC(=O)Nc1cccc(-c2csc(-c3ccccc3Cl)n2)c1 |
| InChI | InChI=1S/C24H27ClN2O2S/c1-3-5-9-17(4-2)15-29-24(28)26-19-11-8-10-18(14-19)22-16-30-23(27-22)20-12-6-7-13-21(20)25/h6-8,10-14,16-17H,3-5,9,15H2,1-2H3,(H,26,28) |
| InChIKey | SWOANSHWRYRHGG-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.01 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |